C32H36N2O5 — CID 70221035
[(4R,4aR,7S,7aR,12bS)-11-hydroxy-7-[methyl-[3-(3-methylphenyl)prop-2-enoyl]amino]-3-prop-2-enyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate (PubChem CID 70221035) has the molecular formula C32H36N2O5 and a molecular weight of 528.65 g/mol. Its IUPAC name is [(4R,4aR,7S,7aR,12bS)-11-hydroxy-7-[methyl-[3-(3-methylphenyl)prop-2-enoyl]amino]-3-prop-2-enyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate.
| Compound Name | [(4R,4aR,7S,7aR,12bS)-11-hydroxy-7-[methyl-[3-(3-methylphenyl)prop-2-enoyl]amino]-3-prop-2-enyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate |
|---|---|
| PubChem CID | 70221035 |
| Molecular Formula | C32H36N2O5 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | [(4R,4aR,7S,7aR,12bS)-11-hydroxy-7-[methyl-[3-(3-methylphenyl)prop-2-enoyl]amino]-3-prop-2-enyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate |
| SMILES | C=CCN1CC[C@]23c4c5c(O)cc(OC(C)=O)c4O[C@H]2[C@@H](N(C)C(=O)C=Cc2cccc(C)c2)CC[C@H]3[C@H]1C5 |
| InChI | InChI=1S/C32H36N2O5/c1-5-14-34-15-13-32-23-10-11-24(33(4)28(37)12-9-21-8-6-7-19(2)16-21)31(32)39-30-27(38-20(3)35)18-26(36)22(29(30)32)17-25(23)34/h5-9,12,16,18,23-25,31,36H,1,10-11,13-15,17H2,2-4H3/t23-,24-,25+,31-,32-/m0/s1 |
| InChIKey | KNUMLNCUZKMNLS-LHECBUNRSA-N |
| XLogP | 4.39 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|