C33H36N2O5 — CID 20639090
[(4R,4aR,7R,7aR,12bS)-7-[3-(3,4-dimethylphenyl)prop-2-ynoyl-methylamino]-9-hydroxy-3-prop-2-enyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate (PubChem CID 20639090) has the molecular formula C33H36N2O5 and a molecular weight of 540.66 g/mol. Its IUPAC name is [(4R,4aR,7R,7aR,12bS)-7-[3-(3,4-dimethylphenyl)prop-2-ynoyl-methylamino]-9-hydroxy-3-prop-2-enyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate.
| Compound Name | [(4R,4aR,7R,7aR,12bS)-7-[3-(3,4-dimethylphenyl)prop-2-ynoyl-methylamino]-9-hydroxy-3-prop-2-enyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate |
|---|---|
| PubChem CID | 20639090 |
| Molecular Formula | C33H36N2O5 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | [(4R,4aR,7R,7aR,12bS)-7-[3-(3,4-dimethylphenyl)prop-2-ynoyl-methylamino]-9-hydroxy-3-prop-2-enyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate |
| SMILES | C=CCN1CC[C@]23c4c5c(OC(C)=O)cc(O)c4O[C@H]2[C@H](N(C)C(=O)C#Cc2ccc(C)c(C)c2)CC[C@H]3[C@H]1C5 |
| InChI | InChI=1S/C33H36N2O5/c1-6-14-35-15-13-33-24-10-11-25(34(5)29(38)12-9-22-8-7-19(2)20(3)16-22)32(33)40-31-27(37)18-28(39-21(4)36)23(30(31)33)17-26(24)35/h6-8,16,18,24-26,32,37H,1,10-11,13-15,17H2,2-5H3/t24-,25+,26+,32-,33-/m0/s1 |
| InChIKey | NONGNIIXSFXBMU-OSJXVIOSSA-N |
| XLogP | 4.04 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|