C38H40N2O4 — CID 20639393
[(4R,4aR,7R,7aR,12bS)-7-[3-(3,4-dimethylphenyl)prop-2-ynoyl-methylamino]-3-(2-phenylethyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate (PubChem CID 20639393) has the molecular formula C38H40N2O4 and a molecular weight of 588.75 g/mol. Its IUPAC name is [(4R,4aR,7R,7aR,12bS)-7-[3-(3,4-dimethylphenyl)prop-2-ynoyl-methylamino]-3-(2-phenylethyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate.
| Compound Name | [(4R,4aR,7R,7aR,12bS)-7-[3-(3,4-dimethylphenyl)prop-2-ynoyl-methylamino]-3-(2-phenylethyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate |
|---|---|
| PubChem CID | 20639393 |
| Molecular Formula | C38H40N2O4 |
| Molecular Weight | 588.75 g/mol |
| Exact Mass | 588.30 |
| IUPAC Name | [(4R,4aR,7R,7aR,12bS)-7-[3-(3,4-dimethylphenyl)prop-2-ynoyl-methylamino]-3-(2-phenylethyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c3c1C[C@@H]1[C@@H]4CC[C@@H](N(C)C(=O)C#Cc5ccc(C)c(C)c5)[C@H](O2)[C@]34CCN1CCc1ccccc1 |
| InChI | InChI=1S/C38H40N2O4/c1-24-10-11-28(22-25(24)2)12-17-35(42)39(4)31-14-13-30-32-23-29-33(43-26(3)41)15-16-34-36(29)38(30,37(31)44-34)19-21-40(32)20-18-27-8-6-5-7-9-27/h5-11,15-16,22,30-32,37H,13-14,18-21,23H2,1-4H3/t30-,31+,32+,37-,38-/m0/s1 |
| InChIKey | PNVWRGMVISSELA-REKGBEETSA-N |
| XLogP | 5.39 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.75 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|