C33H36N2O4 — CID 20639207
[(4R,4aR,7R,7aR,12bS)-3-(cyclopropylmethyl)-7-[methyl-[3-(3-methylphenyl)prop-2-ynoyl]amino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate (PubChem CID 20639207) has the molecular formula C33H36N2O4 and a molecular weight of 524.66 g/mol. Its IUPAC name is [(4R,4aR,7R,7aR,12bS)-3-(cyclopropylmethyl)-7-[methyl-[3-(3-methylphenyl)prop-2-ynoyl]amino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate.
| Compound Name | [(4R,4aR,7R,7aR,12bS)-3-(cyclopropylmethyl)-7-[methyl-[3-(3-methylphenyl)prop-2-ynoyl]amino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate |
|---|---|
| PubChem CID | 20639207 |
| Molecular Formula | C33H36N2O4 |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.27 |
| IUPAC Name | [(4R,4aR,7R,7aR,12bS)-3-(cyclopropylmethyl)-7-[methyl-[3-(3-methylphenyl)prop-2-ynoyl]amino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c3c1C[C@@H]1[C@@H]4CC[C@@H](N(C)C(=O)C#Cc5cccc(C)c5)[C@H](O2)[C@]34CCN1CC1CC1 |
| InChI | InChI=1S/C33H36N2O4/c1-20-5-4-6-22(17-20)9-14-30(37)34(3)26-11-10-25-27-18-24-28(38-21(2)36)12-13-29-31(24)33(25,32(26)39-29)15-16-35(27)19-23-7-8-23/h4-6,12-13,17,23,25-27,32H,7-8,10-11,15-16,18-19H2,1-3H3/t25-,26+,27+,32-,33-/m0/s1 |
| InChIKey | WHNPXDVCMINMHN-NZTNQRDRSA-N |
| XLogP | 4.25 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|