C33H42N2O5S — CID 70217908
[(4R,4aR,7R,7aR,12bS)-7-[benzylsulfonyl(2-methylpropyl)amino]-3-(cyclopropylmethyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate (PubChem CID 70217908) has the molecular formula C33H42N2O5S and a molecular weight of 578.78 g/mol. Its IUPAC name is [(4R,4aR,7R,7aR,12bS)-7-[benzylsulfonyl(2-methylpropyl)amino]-3-(cyclopropylmethyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate.
| Compound Name | [(4R,4aR,7R,7aR,12bS)-7-[benzylsulfonyl(2-methylpropyl)amino]-3-(cyclopropylmethyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate |
|---|---|
| PubChem CID | 70217908 |
| Molecular Formula | C33H42N2O5S |
| Molecular Weight | 578.78 g/mol |
| Exact Mass | 578.28 |
| IUPAC Name | [(4R,4aR,7R,7aR,12bS)-7-[benzylsulfonyl(2-methylpropyl)amino]-3-(cyclopropylmethyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c3c1C[C@@H]1[C@@H]4CC[C@@H](N(CC(C)C)S(=O)(=O)Cc5ccccc5)[C@H](O2)[C@]34CCN1CC1CC1 |
| InChI | InChI=1S/C33H42N2O5S/c1-21(2)18-35(41(37,38)20-24-7-5-4-6-8-24)27-12-11-26-28-17-25-29(39-22(3)36)13-14-30-31(25)33(26,32(27)40-30)15-16-34(28)19-23-9-10-23/h4-8,13-14,21,23,26-28,32H,9-12,15-20H2,1-3H3/t26-,27+,28+,32-,33-/m0/s1 |
| InChIKey | LGCFBZRGBVVKFJ-FMINFEDTSA-N |
| XLogP | 4.92 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.78 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|