C27H32N2O6S — CID 70221334
[(4R,4aR,7R,7aR,12bS)-7-[benzylsulfonyl(methyl)amino]-9-hydroxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate (PubChem CID 70221334) has the molecular formula C27H32N2O6S and a molecular weight of 512.63 g/mol. Its IUPAC name is [(4R,4aR,7R,7aR,12bS)-7-[benzylsulfonyl(methyl)amino]-9-hydroxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate.
| Compound Name | [(4R,4aR,7R,7aR,12bS)-7-[benzylsulfonyl(methyl)amino]-9-hydroxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate |
|---|---|
| PubChem CID | 70221334 |
| Molecular Formula | C27H32N2O6S |
| Molecular Weight | 512.63 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | [(4R,4aR,7R,7aR,12bS)-7-[benzylsulfonyl(methyl)amino]-9-hydroxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate |
| SMILES | CC(=O)Oc1cc(O)c2c3c1C[C@@H]1[C@@H]4CC[C@@H](N(C)S(=O)(=O)Cc5ccccc5)[C@H](O2)[C@]34CCN1C |
| InChI | InChI=1S/C27H32N2O6S/c1-16(30)34-23-14-22(31)25-24-18(23)13-21-19-9-10-20(26(35-25)27(19,24)11-12-28(21)2)29(3)36(32,33)15-17-7-5-4-6-8-17/h4-8,14,19-21,26,31H,9-13,15H2,1-3H3/t19-,20+,21+,26-,27-/m0/s1 |
| InChIKey | OISOTZUNQKMWRV-VXRGYVIQSA-N |
| XLogP | 2.82 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.63 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|