C28H30Cl2N2O5 — CID 70221491
[(4R,4aR,7S,7aR,12bS)-7-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-11-hydroxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate (PubChem CID 70221491) has the molecular formula C28H30Cl2N2O5 and a molecular weight of 545.46 g/mol. Its IUPAC name is [(4R,4aR,7S,7aR,12bS)-7-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-11-hydroxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate.
| Compound Name | [(4R,4aR,7S,7aR,12bS)-7-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-11-hydroxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate |
|---|---|
| PubChem CID | 70221491 |
| Molecular Formula | C28H30Cl2N2O5 |
| Molecular Weight | 545.46 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | [(4R,4aR,7S,7aR,12bS)-7-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-11-hydroxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate |
| SMILES | CC(=O)Oc1cc(O)c2c3c1O[C@H]1[C@@H](N(C)C(=O)Cc4ccc(Cl)c(Cl)c4)CC[C@H]4[C@@H](C2)N(C)CC[C@@]341 |
| InChI | InChI=1S/C28H30Cl2N2O5/c1-14(33)36-23-13-22(34)16-12-21-17-5-7-20(27-28(17,8-9-31(21)2)25(16)26(23)37-27)32(3)24(35)11-15-4-6-18(29)19(30)10-15/h4,6,10,13,17,20-21,27,34H,5,7-9,11-12H2,1-3H3/t17-,20-,21+,27-,28-/m0/s1 |
| InChIKey | ZIXSSHKLROEHGF-JXHHXTKQSA-N |
| XLogP | 4.36 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|