C30H32Cl2N2O4 — CID 57235788
3-[(4R,4aR,7S,7aR,12bS)-7-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]prop-1-en-2-yl acetate (PubChem CID 57235788) has the molecular formula C30H32Cl2N2O4 and a molecular weight of 555.50 g/mol. Its IUPAC name is 3-[(4R,4aR,7S,7aR,12bS)-7-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]prop-1-en-2-yl acetate.
| Compound Name | 3-[(4R,4aR,7S,7aR,12bS)-7-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]prop-1-en-2-yl acetate |
|---|---|
| PubChem CID | 57235788 |
| Molecular Formula | C30H32Cl2N2O4 |
| Molecular Weight | 555.50 g/mol |
| Exact Mass | 554.17 |
| IUPAC Name | 3-[(4R,4aR,7S,7aR,12bS)-7-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]prop-1-en-2-yl acetate |
| SMILES | C=C(CN1CC[C@]23c4c5cccc4O[C@H]2[C@@H](N(C)C(=O)Cc2ccc(Cl)c(Cl)c2)CC[C@H]3[C@H]1C5)OC(C)=O |
| InChI | InChI=1S/C30H32Cl2N2O4/c1-17(37-18(2)35)16-34-12-11-30-21-8-10-24(33(3)27(36)14-19-7-9-22(31)23(32)13-19)29(30)38-26-6-4-5-20(28(26)30)15-25(21)34/h4-7,9,13,21,24-25,29H,1,8,10-12,14-16H2,2-3H3/t21-,24-,25+,29-,30-/m0/s1 |
| InChIKey | SODISVNDNABOJT-VMOYKJEISA-N |
| XLogP | 5.18 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.50 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|