C35H36Cl2N2O4 — CID 70221075
[(4R,4aS,7R,7aR,12bS)-7-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-3-(2-phenylethyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] acetate (PubChem CID 70221075) has the molecular formula C35H36Cl2N2O4 and a molecular weight of 619.59 g/mol. Its IUPAC name is [(4R,4aS,7R,7aR,12bS)-7-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-3-(2-phenylethyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] acetate.
| Compound Name | [(4R,4aS,7R,7aR,12bS)-7-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-3-(2-phenylethyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] acetate |
|---|---|
| PubChem CID | 70221075 |
| Molecular Formula | C35H36Cl2N2O4 |
| Molecular Weight | 619.59 g/mol |
| Exact Mass | 618.21 |
| IUPAC Name | [(4R,4aS,7R,7aR,12bS)-7-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-3-(2-phenylethyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] acetate |
| SMILES | CC(=O)O[C@@]12CC[C@@H](N(C)C(=O)Cc3ccc(Cl)c(Cl)c3)[C@@H]3Oc4cccc5c4[C@@]31CCN(CCc1ccccc1)[C@@H]2C5 |
| InChI | InChI=1S/C35H36Cl2N2O4/c1-22(40)43-35-15-13-28(38(2)31(41)20-24-11-12-26(36)27(37)19-24)33-34(35)16-18-39(17-14-23-7-4-3-5-8-23)30(35)21-25-9-6-10-29(42-33)32(25)34/h3-12,19,28,30,33H,13-18,20-21H2,1-2H3/t28-,30-,33+,34+,35-/m1/s1 |
| InChIKey | PCXIMQLBUNHGRU-QQDOSJPLSA-N |
| XLogP | 6.03 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.59 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |