C34H38N2O6S — CID 70217475
[(4R,4aS,12bS)-7-[benzylsulfonyl(methyl)amino]-9-hydroxy-3-(2-phenylethyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] acetate (PubChem CID 70217475) has the molecular formula C34H38N2O6S and a molecular weight of 602.75 g/mol. Its IUPAC name is [(4R,4aS,12bS)-7-[benzylsulfonyl(methyl)amino]-9-hydroxy-3-(2-phenylethyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] acetate.
| Compound Name | [(4R,4aS,12bS)-7-[benzylsulfonyl(methyl)amino]-9-hydroxy-3-(2-phenylethyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] acetate |
|---|---|
| PubChem CID | 70217475 |
| Molecular Formula | C34H38N2O6S |
| Molecular Weight | 602.75 g/mol |
| Exact Mass | 602.25 |
| IUPAC Name | [(4R,4aS,12bS)-7-[benzylsulfonyl(methyl)amino]-9-hydroxy-3-(2-phenylethyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] acetate |
| SMILES | CC(=O)O[C@@]12CCC(N(C)S(=O)(=O)Cc3ccccc3)C3Oc4c(O)ccc5c4[C@@]31CCN(CCc1ccccc1)[C@@H]2C5 |
| InChI | InChI=1S/C34H38N2O6S/c1-23(37)42-34-17-15-27(35(2)43(39,40)22-25-11-7-4-8-12-25)32-33(34)18-20-36(19-16-24-9-5-3-6-10-24)29(34)21-26-13-14-28(38)31(41-32)30(26)33/h3-14,27,29,32,38H,15-22H2,1-2H3/t27?,29-,32?,33+,34-/m1/s1 |
| InChIKey | ASGUFHBESFGRCB-KQXLQOCUSA-N |
| XLogP | 4.19 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.75 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |