C32H33F3N2O5 — CID 70220959
[(4R,4aS,12bS)-9-hydroxy-7-[methyl-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] acetate (PubChem CID 70220959) has the molecular formula C32H33F3N2O5 and a molecular weight of 582.62 g/mol. Its IUPAC name is [(4R,4aS,12bS)-9-hydroxy-7-[methyl-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] acetate.
| Compound Name | [(4R,4aS,12bS)-9-hydroxy-7-[methyl-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] acetate |
|---|---|
| PubChem CID | 70220959 |
| Molecular Formula | C32H33F3N2O5 |
| Molecular Weight | 582.62 g/mol |
| Exact Mass | 582.23 |
| IUPAC Name | [(4R,4aS,12bS)-9-hydroxy-7-[methyl-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] acetate |
| SMILES | C=CCN1CC[C@]23c4c5ccc(O)c4OC2C(N(C)C(=O)/C=C/c2ccc(C(F)(F)F)cc2)CC[C@@]3(OC(C)=O)[C@H]1C5 |
| InChI | InChI=1S/C32H33F3N2O5/c1-4-16-37-17-15-30-27-21-8-11-24(39)28(27)41-29(30)23(13-14-31(30,25(37)18-21)42-19(2)38)36(3)26(40)12-7-20-5-9-22(10-6-20)32(33,34)35/h4-12,23,25,29,39H,1,13-18H2,2-3H3/b12-7+/t23?,25-,29?,30+,31-/m1/s1 |
| InChIKey | MHGMRNQARHRWJD-YEZAIJIYSA-N |
| XLogP | 4.86 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.62 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|