C39H44N2O5 — CID 70220189
[(4R,4aS,12bS)-9-hydroxy-7-[2-methylpropyl-[(E)-3-phenylprop-2-enoyl]amino]-3-(2-phenylethyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] acetate (PubChem CID 70220189) has the molecular formula C39H44N2O5 and a molecular weight of 620.79 g/mol. Its IUPAC name is [(4R,4aS,12bS)-9-hydroxy-7-[2-methylpropyl-[(E)-3-phenylprop-2-enoyl]amino]-3-(2-phenylethyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] acetate.
| Compound Name | [(4R,4aS,12bS)-9-hydroxy-7-[2-methylpropyl-[(E)-3-phenylprop-2-enoyl]amino]-3-(2-phenylethyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] acetate |
|---|---|
| PubChem CID | 70220189 |
| Molecular Formula | C39H44N2O5 |
| Molecular Weight | 620.79 g/mol |
| Exact Mass | 620.33 |
| IUPAC Name | [(4R,4aS,12bS)-9-hydroxy-7-[2-methylpropyl-[(E)-3-phenylprop-2-enoyl]amino]-3-(2-phenylethyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] acetate |
| SMILES | CC(=O)O[C@@]12CCC(N(CC(C)C)C(=O)/C=C/c3ccccc3)C3Oc4c(O)ccc5c4[C@@]31CCN(CCc1ccccc1)[C@@H]2C5 |
| InChI | InChI=1S/C39H44N2O5/c1-26(2)25-41(34(44)17-14-28-10-6-4-7-11-28)31-18-20-39(46-27(3)42)33-24-30-15-16-32(43)36-35(30)38(39,37(31)45-36)21-23-40(33)22-19-29-12-8-5-9-13-29/h4-17,26,31,33,37,43H,18-25H2,1-3H3/b17-14+/t31?,33-,37?,38+,39-/m1/s1 |
| InChIKey | HCDYAEZOGVUQDK-HARMDJAUSA-N |
| XLogP | 5.93 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.79 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|