C34H38N2O5S — CID 70222314
[(4R,4aS,7S,7aR,12bS)-7-[(2-methylphenyl)methylsulfonylamino]-3-(2-phenylethyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] acetate (PubChem CID 70222314) has the molecular formula C34H38N2O5S and a molecular weight of 586.75 g/mol. Its IUPAC name is [(4R,4aS,7S,7aR,12bS)-7-[(2-methylphenyl)methylsulfonylamino]-3-(2-phenylethyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] acetate.
| Compound Name | [(4R,4aS,7S,7aR,12bS)-7-[(2-methylphenyl)methylsulfonylamino]-3-(2-phenylethyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] acetate |
|---|---|
| PubChem CID | 70222314 |
| Molecular Formula | C34H38N2O5S |
| Molecular Weight | 586.75 g/mol |
| Exact Mass | 586.25 |
| IUPAC Name | [(4R,4aS,7S,7aR,12bS)-7-[(2-methylphenyl)methylsulfonylamino]-3-(2-phenylethyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] acetate |
| SMILES | CC(=O)O[C@@]12CC[C@H](NS(=O)(=O)Cc3ccccc3C)[C@@H]3Oc4cccc5c4[C@@]31CCN(CCc1ccccc1)[C@@H]2C5 |
| InChI | InChI=1S/C34H38N2O5S/c1-23-9-6-7-12-27(23)22-42(38,39)35-28-15-17-34(41-24(2)37)30-21-26-13-8-14-29-31(26)33(34,32(28)40-29)18-20-36(30)19-16-25-10-4-3-5-11-25/h3-14,28,30,32,35H,15-22H2,1-2H3/t28-,30+,32-,33-,34+/m0/s1 |
| InChIKey | HRPGZSWAEFAOJG-JRGQEKSHSA-N |
| XLogP | 4.45 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.75 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |