C32H40N2O7S — CID 57288723
[(4R,4aS,12bS)-4a-acetyloxy-7-[benzylsulfonyl(2-methylpropyl)amino]-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate (PubChem CID 57288723) has the molecular formula C32H40N2O7S and a molecular weight of 596.75 g/mol. Its IUPAC name is [(4R,4aS,12bS)-4a-acetyloxy-7-[benzylsulfonyl(2-methylpropyl)amino]-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate.
| Compound Name | [(4R,4aS,12bS)-4a-acetyloxy-7-[benzylsulfonyl(2-methylpropyl)amino]-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate |
|---|---|
| PubChem CID | 57288723 |
| Molecular Formula | C32H40N2O7S |
| Molecular Weight | 596.75 g/mol |
| Exact Mass | 596.26 |
| IUPAC Name | [(4R,4aS,12bS)-4a-acetyloxy-7-[benzylsulfonyl(2-methylpropyl)amino]-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c3c1OC1C(N(CC(C)C)S(=O)(=O)Cc4ccccc4)CC[C@@]4(OC(C)=O)[C@@H](C2)N(C)CC[C@]314 |
| InChI | InChI=1S/C32H40N2O7S/c1-20(2)18-34(42(37,38)19-23-9-7-6-8-10-23)25-13-14-32(41-22(4)36)27-17-24-11-12-26(39-21(3)35)29-28(24)31(32,30(25)40-29)15-16-33(27)5/h6-12,20,25,27,30H,13-19H2,1-5H3/t25?,27-,30?,31+,32-/m1/s1 |
| InChIKey | YNSQJRALYKJCIV-ZBLKJXCESA-N |
| XLogP | 3.82 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.75 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|