C31H36Cl2N2O5 — CID 70220972
[(4R,4aS,12bS)-7-[[2-(3,4-dichlorophenyl)acetyl]-(2-methylpropyl)amino]-4a-hydroxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate (PubChem CID 70220972) has the molecular formula C31H36Cl2N2O5 and a molecular weight of 587.54 g/mol. Its IUPAC name is [(4R,4aS,12bS)-7-[[2-(3,4-dichlorophenyl)acetyl]-(2-methylpropyl)amino]-4a-hydroxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate.
| Compound Name | [(4R,4aS,12bS)-7-[[2-(3,4-dichlorophenyl)acetyl]-(2-methylpropyl)amino]-4a-hydroxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate |
|---|---|
| PubChem CID | 70220972 |
| Molecular Formula | C31H36Cl2N2O5 |
| Molecular Weight | 587.54 g/mol |
| Exact Mass | 586.20 |
| IUPAC Name | [(4R,4aS,12bS)-7-[[2-(3,4-dichlorophenyl)acetyl]-(2-methylpropyl)amino]-4a-hydroxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c3c1OC1C(N(CC(C)C)C(=O)Cc4ccc(Cl)c(Cl)c4)CC[C@@]4(O)[C@@H](C2)N(C)CC[C@]314 |
| InChI | InChI=1S/C31H36Cl2N2O5/c1-17(2)16-35(26(37)14-19-5-7-21(32)22(33)13-19)23-9-10-31(38)25-15-20-6-8-24(39-18(3)36)28-27(20)30(31,29(23)40-28)11-12-34(25)4/h5-8,13,17,23,25,29,38H,9-12,14-16H2,1-4H3/t23?,25-,29?,30+,31-/m1/s1 |
| InChIKey | IOMWOGNNGRTNEI-PUVMJZRPSA-N |
| XLogP | 4.80 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.54 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|