C22H30N2O2S — CID 16887899
1-(2-methylphenyl)-N-[[1-(2-phenylethyl)piperidin-4-yl]methyl]methanesulfonamide (PubChem CID 16887899) has the molecular formula C22H30N2O2S and a molecular weight of 386.56 g/mol. Its IUPAC name is 1-(2-methylphenyl)-N-[[1-(2-phenylethyl)piperidin-4-yl]methyl]methanesulfonamide.
| Compound Name | 1-(2-methylphenyl)-N-[[1-(2-phenylethyl)piperidin-4-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 16887899 |
| Molecular Formula | C22H30N2O2S |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 1-(2-methylphenyl)-N-[[1-(2-phenylethyl)piperidin-4-yl]methyl]methanesulfonamide |
| SMILES | Cc1ccccc1CS(=O)(=O)NCC1CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C22H30N2O2S/c1-19-7-5-6-10-22(19)18-27(25,26)23-17-21-12-15-24(16-13-21)14-11-20-8-3-2-4-9-20/h2-10,21,23H,11-18H2,1H3 |
| InChIKey | JUMUJSLUCBYNIZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |