C17H29N3O2S — CID 56745274
4-[[[ethyl(methyl)sulfamoyl]amino]methyl]-1-[(2-methylphenyl)methyl]piperidine (PubChem CID 56745274) has the molecular formula C17H29N3O2S and a molecular weight of 339.50 g/mol. Its IUPAC name is 4-[[[ethyl(methyl)sulfamoyl]amino]methyl]-1-[(2-methylphenyl)methyl]piperidine.
| Compound Name | 4-[[[ethyl(methyl)sulfamoyl]amino]methyl]-1-[(2-methylphenyl)methyl]piperidine |
|---|---|
| PubChem CID | 56745274 |
| Molecular Formula | C17H29N3O2S |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | 4-[[[ethyl(methyl)sulfamoyl]amino]methyl]-1-[(2-methylphenyl)methyl]piperidine |
| SMILES | CCN(C)S(=O)(=O)NCC1CCN(Cc2ccccc2C)CC1 |
| InChI | InChI=1S/C17H29N3O2S/c1-4-19(3)23(21,22)18-13-16-9-11-20(12-10-16)14-17-8-6-5-7-15(17)2/h5-8,16,18H,4,9-14H2,1-3H3 |
| InChIKey | TWFNAIJQRLZQQC-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |