C21H27ClN2O2S — CID 16887905
1-(2-chlorophenyl)-N-[[1-(2-phenylethyl)piperidin-4-yl]methyl]methanesulfonamide (PubChem CID 16887905) has the molecular formula C21H27ClN2O2S and a molecular weight of 406.98 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-[[1-(2-phenylethyl)piperidin-4-yl]methyl]methanesulfonamide.
| Compound Name | 1-(2-chlorophenyl)-N-[[1-(2-phenylethyl)piperidin-4-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 16887905 |
| Molecular Formula | C21H27ClN2O2S |
| Molecular Weight | 406.98 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 1-(2-chlorophenyl)-N-[[1-(2-phenylethyl)piperidin-4-yl]methyl]methanesulfonamide |
| SMILES | O=S(=O)(Cc1ccccc1Cl)NCC1CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C21H27ClN2O2S/c22-21-9-5-4-8-20(21)17-27(25,26)23-16-19-11-14-24(15-12-19)13-10-18-6-2-1-3-7-18/h1-9,19,23H,10-17H2 |
| InChIKey | XYCSUPDKGGTIPT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.98 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |