C32H31F3N2O4 — CID 57049690
3-[(4R,4aR,7S,7aR,12bS)-7-[methyl-[3-[4-(trifluoromethyl)phenyl]prop-2-ynoyl]amino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]prop-1-en-2-yl acetate (PubChem CID 57049690) has the molecular formula C32H31F3N2O4 and a molecular weight of 564.60 g/mol. Its IUPAC name is 3-[(4R,4aR,7S,7aR,12bS)-7-[methyl-[3-[4-(trifluoromethyl)phenyl]prop-2-ynoyl]amino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]prop-1-en-2-yl acetate.
| Compound Name | 3-[(4R,4aR,7S,7aR,12bS)-7-[methyl-[3-[4-(trifluoromethyl)phenyl]prop-2-ynoyl]amino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]prop-1-en-2-yl acetate |
|---|---|
| PubChem CID | 57049690 |
| Molecular Formula | C32H31F3N2O4 |
| Molecular Weight | 564.60 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | 3-[(4R,4aR,7S,7aR,12bS)-7-[methyl-[3-[4-(trifluoromethyl)phenyl]prop-2-ynoyl]amino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]prop-1-en-2-yl acetate |
| SMILES | C=C(CN1CC[C@]23c4c5cccc4O[C@H]2[C@@H](N(C)C(=O)C#Cc2ccc(C(F)(F)F)cc2)CC[C@H]3[C@H]1C5)OC(C)=O |
| InChI | InChI=1S/C32H31F3N2O4/c1-19(40-20(2)38)18-37-16-15-31-24-12-13-25(30(31)41-27-6-4-5-22(29(27)31)17-26(24)37)36(3)28(39)14-9-21-7-10-23(11-8-21)32(33,34)35/h4-8,10-11,24-26,30H,1,12-13,15-18H2,2-3H3/t24-,25-,26+,30-,31-/m0/s1 |
| InChIKey | ZAZPZLDYZCFKGS-AWIKLDQISA-N |
| XLogP | 4.70 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.60 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|