C33H38Cl2N2O4 — CID 70220955
[(4R,4aR,7R,7aR,12bS)-7-[[2-(3,4-dichlorophenyl)acetyl]-(2-methylpropyl)amino]-3-prop-2-enyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate (PubChem CID 70220955) has the molecular formula C33H38Cl2N2O4 and a molecular weight of 597.58 g/mol. Its IUPAC name is [(4R,4aR,7R,7aR,12bS)-7-[[2-(3,4-dichlorophenyl)acetyl]-(2-methylpropyl)amino]-3-prop-2-enyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate.
| Compound Name | [(4R,4aR,7R,7aR,12bS)-7-[[2-(3,4-dichlorophenyl)acetyl]-(2-methylpropyl)amino]-3-prop-2-enyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate |
|---|---|
| PubChem CID | 70220955 |
| Molecular Formula | C33H38Cl2N2O4 |
| Molecular Weight | 597.58 g/mol |
| Exact Mass | 596.22 |
| IUPAC Name | [(4R,4aR,7R,7aR,12bS)-7-[[2-(3,4-dichlorophenyl)acetyl]-(2-methylpropyl)amino]-3-prop-2-enyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate |
| SMILES | C=CCN1CC[C@@]23c4c5ccc(OC(C)=O)c4C[C@@H]1[C@@H]2CC[C@@H](N(CC(C)C)C(=O)Cc1ccc(Cl)c(Cl)c1)[C@@H]3O5 |
| InChI | InChI=1S/C33H38Cl2N2O4/c1-5-13-36-14-12-33-23-7-9-26(37(18-19(2)3)30(39)16-21-6-8-24(34)25(35)15-21)32(33)41-29-11-10-28(40-20(4)38)22(31(29)33)17-27(23)36/h5-6,8,10-11,15,19,23,26-27,32H,1,7,9,12-14,16-18H2,2-4H3/t23-,26+,27+,32-,33-/m0/s1 |
| InChIKey | BEUFZTXUKSKEKQ-CSJYAERPSA-N |
| XLogP | 6.24 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.58 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|