C29H32Cl2N2O5 — CID 70217429
[(4R,4aR,7R,7aR,12bS)-7-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-9-methoxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate (PubChem CID 70217429) has the molecular formula C29H32Cl2N2O5 and a molecular weight of 559.49 g/mol. Its IUPAC name is [(4R,4aR,7R,7aR,12bS)-7-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-9-methoxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate.
| Compound Name | [(4R,4aR,7R,7aR,12bS)-7-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-9-methoxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate |
|---|---|
| PubChem CID | 70217429 |
| Molecular Formula | C29H32Cl2N2O5 |
| Molecular Weight | 559.49 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | [(4R,4aR,7R,7aR,12bS)-7-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-9-methoxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate |
| SMILES | COc1cc(OC(C)=O)c2c3c1O[C@H]1[C@H](N(C)C(=O)Cc4ccc(Cl)c(Cl)c4)CC[C@H]4[C@@H](C2)N(C)CC[C@@]341 |
| InChI | InChI=1S/C29H32Cl2N2O5/c1-15(34)37-23-14-24(36-4)27-26-17(23)13-22-18-6-8-21(28(38-27)29(18,26)9-10-32(22)2)33(3)25(35)12-16-5-7-19(30)20(31)11-16/h5,7,11,14,18,21-22,28H,6,8-10,12-13H2,1-4H3/t18-,21+,22+,28-,29-/m0/s1 |
| InChIKey | SPHXPAIBGACWDU-VXDAWVGOSA-N |
| XLogP | 4.67 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|