C27H29BrN2O5S — CID 20639278
[(4R,4aR,7R,7aR,12bS)-7-[[(E)-3-(4-bromothiophen-2-yl)prop-2-enoyl]-methylamino]-9-hydroxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate (PubChem CID 20639278) has the molecular formula C27H29BrN2O5S and a molecular weight of 573.51 g/mol. Its IUPAC name is [(4R,4aR,7R,7aR,12bS)-7-[[(E)-3-(4-bromothiophen-2-yl)prop-2-enoyl]-methylamino]-9-hydroxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate.
| Compound Name | [(4R,4aR,7R,7aR,12bS)-7-[[(E)-3-(4-bromothiophen-2-yl)prop-2-enoyl]-methylamino]-9-hydroxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate |
|---|---|
| PubChem CID | 20639278 |
| Molecular Formula | C27H29BrN2O5S |
| Molecular Weight | 573.51 g/mol |
| Exact Mass | 572.10 |
| IUPAC Name | [(4R,4aR,7R,7aR,12bS)-7-[[(E)-3-(4-bromothiophen-2-yl)prop-2-enoyl]-methylamino]-9-hydroxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate |
| SMILES | CC(=O)Oc1cc(O)c2c3c1C[C@@H]1[C@@H]4CC[C@@H](N(C)C(=O)/C=C/c5cc(Br)cs5)[C@H](O2)[C@]34CCN1C |
| InChI | InChI=1S/C27H29BrN2O5S/c1-14(31)34-22-12-21(32)25-24-17(22)11-20-18-5-6-19(26(35-25)27(18,24)8-9-29(20)2)30(3)23(33)7-4-16-10-15(28)13-36-16/h4,7,10,12-13,18-20,26,32H,5-6,8-9,11H2,1-3H3/b7-4+/t18-,19+,20+,26-,27-/m0/s1 |
| InChIKey | SQLFWUUMZQOICJ-KIOXQKQSSA-N |
| XLogP | 4.35 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|