C26H29BrN2O4S — CID 20639321
(E)-N-[(4R,4aR,7S,7aR,12bS)-11-hydroxy-9-methoxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(4-bromothiophen-2-yl)-N-methylprop-2-enamide (PubChem CID 20639321) has the molecular formula C26H29BrN2O4S and a molecular weight of 545.50 g/mol. Its IUPAC name is (E)-N-[(4R,4aR,7S,7aR,12bS)-11-hydroxy-9-methoxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(4-bromothiophen-2-yl)-N-methylprop-2-enamide.
| Compound Name | (E)-N-[(4R,4aR,7S,7aR,12bS)-11-hydroxy-9-methoxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(4-bromothiophen-2-yl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 20639321 |
| Molecular Formula | C26H29BrN2O4S |
| Molecular Weight | 545.50 g/mol |
| Exact Mass | 544.10 |
| IUPAC Name | (E)-N-[(4R,4aR,7S,7aR,12bS)-11-hydroxy-9-methoxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(4-bromothiophen-2-yl)-N-methylprop-2-enamide |
| SMILES | COc1cc(O)c2c3c1O[C@H]1[C@@H](N(C)C(=O)/C=C/c4cc(Br)cs4)CC[C@H]4[C@@H](C2)N(C)CC[C@@]341 |
| InChI | InChI=1S/C26H29BrN2O4S/c1-28-9-8-26-17-5-6-18(29(2)22(31)7-4-15-10-14(27)13-34-15)25(26)33-24-21(32-3)12-20(30)16(23(24)26)11-19(17)28/h4,7,10,12-13,17-19,25,30H,5-6,8-9,11H2,1-3H3/b7-4+/t17-,18-,19+,25-,26-/m0/s1 |
| InChIKey | ZVPFRPDXJHYXPP-AVGSGQBUSA-N |
| XLogP | 4.43 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|