C36H38N2O3 — CID 20639422
N-[(4R,4aR,7S,7aR,12bS)-11-hydroxy-3-(2-phenylethyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(3,4-dimethylphenyl)-N-methylprop-2-ynamide (PubChem CID 20639422) has the molecular formula C36H38N2O3 and a molecular weight of 546.71 g/mol. Its IUPAC name is N-[(4R,4aR,7S,7aR,12bS)-11-hydroxy-3-(2-phenylethyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(3,4-dimethylphenyl)-N-methylprop-2-ynamide.
| Compound Name | N-[(4R,4aR,7S,7aR,12bS)-11-hydroxy-3-(2-phenylethyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(3,4-dimethylphenyl)-N-methylprop-2-ynamide |
|---|---|
| PubChem CID | 20639422 |
| Molecular Formula | C36H38N2O3 |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.29 |
| IUPAC Name | N-[(4R,4aR,7S,7aR,12bS)-11-hydroxy-3-(2-phenylethyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(3,4-dimethylphenyl)-N-methylprop-2-ynamide |
| SMILES | Cc1ccc(C#CC(=O)N(C)[C@H]2CC[C@H]3[C@H]4Cc5c(O)ccc6c5[C@@]3(CCN4CCc3ccccc3)[C@H]2O6)cc1C |
| InChI | InChI=1S/C36H38N2O3/c1-23-9-10-26(21-24(23)2)11-16-33(40)37(3)29-13-12-28-30-22-27-31(39)14-15-32-34(27)36(28,35(29)41-32)18-20-38(30)19-17-25-7-5-4-6-8-25/h4-10,14-15,21,28-30,35,39H,12-13,17-20,22H2,1-3H3/t28-,29-,30+,35-,36-/m0/s1 |
| InChIKey | RUUFLXRHMUDABB-YEWHAIJASA-N |
| XLogP | 5.17 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|