C30H34N2O6 — CID 57092086
[2-[[(4R,4aR,7R,7aR,12bS)-7-[3-(furan-3-yl)prop-2-enoyl-methylamino]-9-hydroxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]methyl]cyclopropyl] acetate (PubChem CID 57092086) has the molecular formula C30H34N2O6 and a molecular weight of 518.61 g/mol. Its IUPAC name is [2-[[(4R,4aR,7R,7aR,12bS)-7-[3-(furan-3-yl)prop-2-enoyl-methylamino]-9-hydroxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]methyl]cyclopropyl] acetate.
| Compound Name | [2-[[(4R,4aR,7R,7aR,12bS)-7-[3-(furan-3-yl)prop-2-enoyl-methylamino]-9-hydroxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]methyl]cyclopropyl] acetate |
|---|---|
| PubChem CID | 57092086 |
| Molecular Formula | C30H34N2O6 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | [2-[[(4R,4aR,7R,7aR,12bS)-7-[3-(furan-3-yl)prop-2-enoyl-methylamino]-9-hydroxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]methyl]cyclopropyl] acetate |
| SMILES | CC(=O)OC1CC1CN1CC[C@]23c4c5ccc(O)c4O[C@H]2[C@H](N(C)C(=O)C=Cc2ccoc2)CC[C@H]3[C@H]1C5 |
| InChI | InChI=1S/C30H34N2O6/c1-17(33)37-25-14-20(25)15-32-11-10-30-21-5-6-22(31(2)26(35)8-3-18-9-12-36-16-18)29(30)38-28-24(34)7-4-19(27(28)30)13-23(21)32/h3-4,7-9,12,16,20-23,25,29,34H,5-6,10-11,13-15H2,1-2H3/t20?,21-,22+,23+,25?,29-,30-/m0/s1 |
| InChIKey | QKEJUZGBQAEPOM-MSOCUKDVSA-N |
| XLogP | 3.52 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|