C32H38N2O6 — CID 57115889
3-[(4R,4aR,7S,7aR,12bS)-7-[3-(furan-3-yl)prop-2-enoyl-(2-methylpropyl)amino]-9-hydroxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]prop-1-en-2-yl acetate (PubChem CID 57115889) has the molecular formula C32H38N2O6 and a molecular weight of 546.66 g/mol. Its IUPAC name is 3-[(4R,4aR,7S,7aR,12bS)-7-[3-(furan-3-yl)prop-2-enoyl-(2-methylpropyl)amino]-9-hydroxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]prop-1-en-2-yl acetate.
| Compound Name | 3-[(4R,4aR,7S,7aR,12bS)-7-[3-(furan-3-yl)prop-2-enoyl-(2-methylpropyl)amino]-9-hydroxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]prop-1-en-2-yl acetate |
|---|---|
| PubChem CID | 57115889 |
| Molecular Formula | C32H38N2O6 |
| Molecular Weight | 546.66 g/mol |
| Exact Mass | 546.27 |
| IUPAC Name | 3-[(4R,4aR,7S,7aR,12bS)-7-[3-(furan-3-yl)prop-2-enoyl-(2-methylpropyl)amino]-9-hydroxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]prop-1-en-2-yl acetate |
| SMILES | C=C(CN1CC[C@]23c4c5ccc(O)c4O[C@H]2[C@@H](N(CC(C)C)C(=O)C=Cc2ccoc2)CC[C@H]3[C@H]1C5)OC(C)=O |
| InChI | InChI=1S/C32H38N2O6/c1-19(2)16-34(28(37)10-5-22-11-14-38-18-22)25-8-7-24-26-15-23-6-9-27(36)30-29(23)32(24,31(25)40-30)12-13-33(26)17-20(3)39-21(4)35/h5-6,9-11,14,18-19,24-26,31,36H,3,7-8,12-13,15-17H2,1-2,4H3/t24-,25-,26+,31-,32-/m0/s1 |
| InChIKey | NYCBGTBPRLINKP-KYFAXXCJSA-N |
| XLogP | 4.67 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.66 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|