C28H34N2O4 — CID 22884585
(E)-N-[(4R,4aR,7R,7aR,12bS)-11-hydroxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(furan-3-yl)-N-(2-methylpropyl)prop-2-enamide (PubChem CID 22884585) has the molecular formula C28H34N2O4 and a molecular weight of 462.59 g/mol. Its IUPAC name is (E)-N-[(4R,4aR,7R,7aR,12bS)-11-hydroxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(furan-3-yl)-N-(2-methylpropyl)prop-2-enamide.
| Compound Name | (E)-N-[(4R,4aR,7R,7aR,12bS)-11-hydroxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(furan-3-yl)-N-(2-methylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 22884585 |
| Molecular Formula | C28H34N2O4 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | (E)-N-[(4R,4aR,7R,7aR,12bS)-11-hydroxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(furan-3-yl)-N-(2-methylpropyl)prop-2-enamide |
| SMILES | CC(C)CN(C(=O)/C=C/c1ccoc1)[C@@H]1CC[C@H]2[C@H]3Cc4c(O)ccc5c4[C@@]2(CCN3C)[C@H]1O5 |
| InChI | InChI=1S/C28H34N2O4/c1-17(2)15-30(25(32)9-4-18-10-13-33-16-18)21-6-5-20-22-14-19-23(31)7-8-24-26(19)28(20,27(21)34-24)11-12-29(22)3/h4,7-10,13,16-17,20-22,27,31H,5-6,11-12,14-15H2,1-3H3/b9-4+/t20-,21+,22+,27-,28-/m0/s1 |
| InChIKey | YAGFQDDIMCVDAJ-RGFCBMLDSA-N |
| XLogP | 4.22 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|