C34H38N2O5S — CID 57266404
[2-[(4R,4aR,7R,7aR,12bS)-7-[benzylsulfonyl(methyl)amino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]-1-phenylethyl] acetate (PubChem CID 57266404) has the molecular formula C34H38N2O5S and a molecular weight of 586.75 g/mol. Its IUPAC name is [2-[(4R,4aR,7R,7aR,12bS)-7-[benzylsulfonyl(methyl)amino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]-1-phenylethyl] acetate.
| Compound Name | [2-[(4R,4aR,7R,7aR,12bS)-7-[benzylsulfonyl(methyl)amino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]-1-phenylethyl] acetate |
|---|---|
| PubChem CID | 57266404 |
| Molecular Formula | C34H38N2O5S |
| Molecular Weight | 586.75 g/mol |
| Exact Mass | 586.25 |
| IUPAC Name | [2-[(4R,4aR,7R,7aR,12bS)-7-[benzylsulfonyl(methyl)amino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]-1-phenylethyl] acetate |
| SMILES | CC(=O)OC(CN1CC[C@]23c4c5cccc4O[C@H]2[C@H](N(C)S(=O)(=O)Cc2ccccc2)CC[C@H]3[C@H]1C5)c1ccccc1 |
| InChI | InChI=1S/C34H38N2O5S/c1-23(37)40-31(25-12-7-4-8-13-25)21-36-19-18-34-27-16-17-28(35(2)42(38,39)22-24-10-5-3-6-11-24)33(34)41-30-15-9-14-26(32(30)34)20-29(27)36/h3-15,27-29,31,33H,16-22H2,1-2H3/t27-,28+,29+,31?,33-,34-/m0/s1 |
| InChIKey | BXOCUCFREUQAEM-DQMORTOASA-N |
| XLogP | 4.86 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.75 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |