C30H38N2O4S — CID 70220640
N-[(4R,4aS,12bS)-4a-hydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-(2-methylpropyl)-1-phenylmethanesulfonamide (PubChem CID 70220640) has the molecular formula C30H38N2O4S and a molecular weight of 522.71 g/mol. Its IUPAC name is N-[(4R,4aS,12bS)-4a-hydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-(2-methylpropyl)-1-phenylmethanesulfonamide.
| Compound Name | N-[(4R,4aS,12bS)-4a-hydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-(2-methylpropyl)-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 70220640 |
| Molecular Formula | C30H38N2O4S |
| Molecular Weight | 522.71 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | N-[(4R,4aS,12bS)-4a-hydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-(2-methylpropyl)-1-phenylmethanesulfonamide |
| SMILES | C=CCN1CC[C@]23c4c5cccc4OC2C(N(CC(C)C)S(=O)(=O)Cc2ccccc2)CC[C@@]3(O)[C@H]1C5 |
| InChI | InChI=1S/C30H38N2O4S/c1-4-16-31-17-15-29-27-23-11-8-12-25(27)36-28(29)24(13-14-30(29,33)26(31)18-23)32(19-21(2)3)37(34,35)20-22-9-6-5-7-10-22/h4-12,21,24,26,28,33H,1,13-20H2,2-3H3/t24?,26-,28?,29+,30-/m1/s1 |
| InChIKey | NLIZGAQHVPNIKF-PVESDTQISA-N |
| XLogP | 3.88 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.71 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|