C29H32Cl2N2O3 — CID 67812576
(4R,4aS,12bS)-7-[[(E)-3-(3,4-dichlorophenyl)prop-2-enyl]-methylamino]-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol (PubChem CID 67812576) has the molecular formula C29H32Cl2N2O3 and a molecular weight of 527.49 g/mol. Its IUPAC name is (4R,4aS,12bS)-7-[[(E)-3-(3,4-dichlorophenyl)prop-2-enyl]-methylamino]-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol.
| Compound Name | (4R,4aS,12bS)-7-[[(E)-3-(3,4-dichlorophenyl)prop-2-enyl]-methylamino]-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol |
|---|---|
| PubChem CID | 67812576 |
| Molecular Formula | C29H32Cl2N2O3 |
| Molecular Weight | 527.49 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | (4R,4aS,12bS)-7-[[(E)-3-(3,4-dichlorophenyl)prop-2-enyl]-methylamino]-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol |
| SMILES | C=CCN1CC[C@]23c4c5ccc(O)c4OC2C(N(C)C/C=C/c2ccc(Cl)c(Cl)c2)CC[C@@]3(O)[C@H]1C5 |
| InChI | InChI=1S/C29H32Cl2N2O3/c1-3-13-33-15-12-28-25-19-7-9-23(34)26(25)36-27(28)22(10-11-29(28,35)24(33)17-19)32(2)14-4-5-18-6-8-20(30)21(31)16-18/h3-9,16,22,24,27,34-35H,1,10-15,17H2,2H3/b5-4+/t22?,24-,27?,28+,29-/m1/s1 |
| InChIKey | PYALVPFJFRBOJI-CDPLMEPDSA-N |
| XLogP | 5.05 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.49 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|