C27H28Cl2N2O4 — CID 70222014
N-[(4R,4aS,7S,7aR,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-2-(3,4-dichlorophenyl)acetamide (PubChem CID 70222014) has the molecular formula C27H28Cl2N2O4 and a molecular weight of 515.44 g/mol. Its IUPAC name is N-[(4R,4aS,7S,7aR,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-2-(3,4-dichlorophenyl)acetamide.
| Compound Name | N-[(4R,4aS,7S,7aR,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-2-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 70222014 |
| Molecular Formula | C27H28Cl2N2O4 |
| Molecular Weight | 515.44 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | N-[(4R,4aS,7S,7aR,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-2-(3,4-dichlorophenyl)acetamide |
| SMILES | C=CCN1CC[C@]23c4c5ccc(O)c4O[C@H]2[C@@H](NC(=O)Cc2ccc(Cl)c(Cl)c2)CC[C@@]3(O)[C@H]1C5 |
| InChI | InChI=1S/C27H28Cl2N2O4/c1-2-10-31-11-9-26-23-16-4-6-20(32)24(23)35-25(26)19(7-8-27(26,34)21(31)14-16)30-22(33)13-15-3-5-17(28)18(29)12-15/h2-6,12,19,21,25,32,34H,1,7-11,13-14H2,(H,30,33)/t19-,21+,25-,26-,27+/m0/s1 |
| InChIKey | DZPPHMNLXMJCQM-XKVUGNILSA-N |
| XLogP | 3.77 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|