C28H38N2O4 — CID 57241413
N-[(4R,4aS,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-2-cyclohexylpropanamide (PubChem CID 57241413) has the molecular formula C28H38N2O4 and a molecular weight of 466.62 g/mol. Its IUPAC name is N-[(4R,4aS,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-2-cyclohexylpropanamide.
| Compound Name | N-[(4R,4aS,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-2-cyclohexylpropanamide |
|---|---|
| PubChem CID | 57241413 |
| Molecular Formula | C28H38N2O4 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | N-[(4R,4aS,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-2-cyclohexylpropanamide |
| SMILES | C=CCN1CC[C@]23c4c5ccc(O)c4OC2C(NC(=O)C(C)C2CCCCC2)CC[C@@]3(O)[C@H]1C5 |
| InChI | InChI=1S/C28H38N2O4/c1-3-14-30-15-13-27-23-19-9-10-21(31)24(23)34-25(27)20(11-12-28(27,33)22(30)16-19)29-26(32)17(2)18-7-5-4-6-8-18/h3,9-10,17-18,20,22,25,31,33H,1,4-8,11-16H2,2H3,(H,29,32)/t17?,20?,22-,25?,27+,28-/m1/s1 |
| InChIKey | MWRDHMYFBQMJFD-ZJZKOMHGSA-N |
| XLogP | 3.43 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|