C26H28N2O5 — CID 56966723
N-[(4R,4aS,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-hydroxybenzamide (PubChem CID 56966723) has the molecular formula C26H28N2O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is N-[(4R,4aS,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-hydroxybenzamide.
| Compound Name | N-[(4R,4aS,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-hydroxybenzamide |
|---|---|
| PubChem CID | 56966723 |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | N-[(4R,4aS,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-hydroxybenzamide |
| SMILES | C=CCN1CC[C@]23c4c5ccc(O)c4OC2C(NC(=O)c2cccc(O)c2)CC[C@@]3(O)[C@H]1C5 |
| InChI | InChI=1S/C26H28N2O5/c1-2-11-28-12-10-25-21-15-6-7-19(30)22(21)33-23(25)18(8-9-26(25,32)20(28)14-15)27-24(31)16-4-3-5-17(29)13-16/h2-7,13,18,20,23,29-30,32H,1,8-12,14H2,(H,27,31)/t18?,20-,23?,25+,26-/m1/s1 |
| InChIKey | CXONYIWQLLTLGQ-IAUDQODSSA-N |
| XLogP | 2.24 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|