C28H33N3O6 — CID 70222132
N-[(4R,4aS,12bS)-4a,9-dihydroxy-3-methyl-11-nitro-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-methyl-3-(3-methylphenyl)propanamide (PubChem CID 70222132) has the molecular formula C28H33N3O6 and a molecular weight of 507.59 g/mol. Its IUPAC name is N-[(4R,4aS,12bS)-4a,9-dihydroxy-3-methyl-11-nitro-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-methyl-3-(3-methylphenyl)propanamide.
| Compound Name | N-[(4R,4aS,12bS)-4a,9-dihydroxy-3-methyl-11-nitro-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-methyl-3-(3-methylphenyl)propanamide |
|---|---|
| PubChem CID | 70222132 |
| Molecular Formula | C28H33N3O6 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | N-[(4R,4aS,12bS)-4a,9-dihydroxy-3-methyl-11-nitro-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-methyl-3-(3-methylphenyl)propanamide |
| SMILES | Cc1cccc(CCC(=O)N(C)C2CC[C@@]3(O)[C@H]4Cc5c([N+](=O)[O-])cc(O)c6c5[C@@]3(CCN4C)C2O6)c1 |
| InChI | InChI=1S/C28H33N3O6/c1-16-5-4-6-17(13-16)7-8-23(33)30(3)19-9-10-28(34)22-14-18-20(31(35)36)15-21(32)25-24(18)27(28,26(19)37-25)11-12-29(22)2/h4-6,13,15,19,22,26,32,34H,7-12,14H2,1-3H3/t19?,22-,26?,27+,28-/m1/s1 |
| InChIKey | LFYALZVGUFXYBC-VALHUFFOSA-N |
| XLogP | 2.85 |
| TPSA | 116.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|