C33H43N3O4 — CID 174550089
N-[(4R,4aS,7S,7aR,12bS)-3-cyclopropyl-4a,9-dihydroxy-11-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-(aminomethyl)-6-phenylhexanamide (PubChem CID 174550089) has the molecular formula C33H43N3O4 and a molecular weight of 545.72 g/mol. Its IUPAC name is N-[(4R,4aS,7S,7aR,12bS)-3-cyclopropyl-4a,9-dihydroxy-11-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-(aminomethyl)-6-phenylhexanamide.
| Compound Name | N-[(4R,4aS,7S,7aR,12bS)-3-cyclopropyl-4a,9-dihydroxy-11-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-(aminomethyl)-6-phenylhexanamide |
|---|---|
| PubChem CID | 174550089 |
| Molecular Formula | C33H43N3O4 |
| Molecular Weight | 545.72 g/mol |
| Exact Mass | 545.33 |
| IUPAC Name | N-[(4R,4aS,7S,7aR,12bS)-3-cyclopropyl-4a,9-dihydroxy-11-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-(aminomethyl)-6-phenylhexanamide |
| SMILES | Cc1cc(O)c2c3c1C[C@H]1N(C4CC4)CC[C@@]34[C@@H](O2)[C@@H](N(CN)C(=O)CCCCCc2ccccc2)CC[C@@]14O |
| InChI | InChI=1S/C33H43N3O4/c1-21-18-26(37)30-29-24(21)19-27-33(39)15-14-25(31(40-30)32(29,33)16-17-35(27)23-12-13-23)36(20-34)28(38)11-7-3-6-10-22-8-4-2-5-9-22/h2,4-5,8-9,18,23,25,27,31,37,39H,3,6-7,10-17,19-20,34H2,1H3/t25-,27+,31-,32-,33+/m0/s1 |
| InChIKey | DCEYXTZGVWVIGF-DVSRQCRASA-N |
| XLogP | 3.93 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.72 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|