C25H26ClNO6 — CID 140789496
[(4S,4aS,7aR,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] (2S)-2-hydroxy-2-phenylacetate;hydrochloride (PubChem CID 140789496) has the molecular formula C25H26ClNO6 and a molecular weight of 471.94 g/mol. Its IUPAC name is [(4S,4aS,7aR,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] (2S)-2-hydroxy-2-phenylacetate;hydrochloride.
| Compound Name | [(4S,4aS,7aR,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] (2S)-2-hydroxy-2-phenylacetate;hydrochloride |
|---|---|
| PubChem CID | 140789496 |
| Molecular Formula | C25H26ClNO6 |
| Molecular Weight | 471.94 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | [(4S,4aS,7aR,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] (2S)-2-hydroxy-2-phenylacetate;hydrochloride |
| SMILES | CN1CC[C@]23c4c5ccc(O)c4O[C@H]2C(OC(=O)[C@@H](O)c2ccccc2)=CC[C@@]3(O)[C@@H]1C5.Cl |
| InChI | InChI=1S/C25H25NO6.ClH/c1-26-12-11-24-19-15-7-8-16(27)21(19)32-22(24)17(9-10-25(24,30)18(26)13-15)31-23(29)20(28)14-5-3-2-4-6-14;/h2-9,18,20,22,27-28,30H,10-13H2,1H3;1H/t18-,20-,22-,24-,25+;/m0./s1 |
| InChIKey | XOINKSZGSWMEKS-WBYMXTJRSA-N |
| XLogP | 2.37 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.94 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |