C26H27NO6 — CID 140789534
[(4S,4aS,7aR,12bS)-4a-hydroxy-9-methoxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] (2R)-2-hydroxy-2-phenylacetate (PubChem CID 140789534) has the molecular formula C26H27NO6 and a molecular weight of 449.50 g/mol. Its IUPAC name is [(4S,4aS,7aR,12bS)-4a-hydroxy-9-methoxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] (2R)-2-hydroxy-2-phenylacetate.
| Compound Name | [(4S,4aS,7aR,12bS)-4a-hydroxy-9-methoxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] (2R)-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 140789534 |
| Molecular Formula | C26H27NO6 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | [(4S,4aS,7aR,12bS)-4a-hydroxy-9-methoxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] (2R)-2-hydroxy-2-phenylacetate |
| SMILES | COc1ccc2c3c1O[C@H]1C(OC(=O)[C@H](O)c4ccccc4)=CC[C@@]4(O)[C@H](C2)N(C)CC[C@]314 |
| InChI | InChI=1S/C26H27NO6/c1-27-13-12-25-20-16-8-9-17(31-2)22(20)33-23(25)18(10-11-26(25,30)19(27)14-16)32-24(29)21(28)15-6-4-3-5-7-15/h3-10,19,21,23,28,30H,11-14H2,1-2H3/t19-,21+,23-,25-,26+/m0/s1 |
| InChIKey | WQXAYNOKAYLBLB-QHUNPKPRSA-N |
| XLogP | 2.25 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |