C24H29NO9 — CID 129175376
1-O-[(4R,4aS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 4-O-propan-2-yl (2R,3R)-2,3-dihydroxybutanedioate (PubChem CID 129175376) has the molecular formula C24H29NO9 and a molecular weight of 475.49 g/mol. Its IUPAC name is 1-O-[(4R,4aS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 4-O-propan-2-yl (2R,3R)-2,3-dihydroxybutanedioate.
| Compound Name | 1-O-[(4R,4aS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 4-O-propan-2-yl (2R,3R)-2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 129175376 |
| Molecular Formula | C24H29NO9 |
| Molecular Weight | 475.49 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 1-O-[(4R,4aS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 4-O-propan-2-yl (2R,3R)-2,3-dihydroxybutanedioate |
| SMILES | CC(C)OC(=O)[C@H](O)[C@@H](O)C(=O)OC1=CC[C@@]2(O)[C@H]3Cc4ccc(O)c5c4C2(CCN3C)C1O5 |
| InChI | InChI=1S/C24H29NO9/c1-11(2)32-21(29)17(27)18(28)22(30)33-14-6-7-24(31)15-10-12-4-5-13(26)19-16(12)23(24,20(14)34-19)8-9-25(15)3/h4-6,11,15,17-18,20,26-28,31H,7-10H2,1-3H3/t15-,17-,18-,20?,23?,24-/m1/s1 |
| InChIKey | JAMYADYOBXGGND-IKIVOTTPSA-N |
| XLogP | -0.11 |
| TPSA | 145.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.49 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |