C25H29NO9 — CID 129184819
[(2S)-1-[[(4R,4aS,7aR)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-1-oxopropan-2-yl] (2S)-2-acetyloxypropanoate (PubChem CID 129184819) has the molecular formula C25H29NO9 and a molecular weight of 487.51 g/mol. Its IUPAC name is [(2S)-1-[[(4R,4aS,7aR)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-1-oxopropan-2-yl] (2S)-2-acetyloxypropanoate.
| Compound Name | [(2S)-1-[[(4R,4aS,7aR)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-1-oxopropan-2-yl] (2S)-2-acetyloxypropanoate |
|---|---|
| PubChem CID | 129184819 |
| Molecular Formula | C25H29NO9 |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | [(2S)-1-[[(4R,4aS,7aR)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-1-oxopropan-2-yl] (2S)-2-acetyloxypropanoate |
| SMILES | CC(=O)O[C@@H](C)C(=O)O[C@@H](C)C(=O)OC1=CC[C@@]2(O)[C@H]3Cc4ccc(O)c5c4C2(CCN3C)[C@H]1O5 |
| InChI | InChI=1S/C25H29NO9/c1-12(32-14(3)27)22(29)33-13(2)23(30)34-17-7-8-25(31)18-11-15-5-6-16(28)20-19(15)24(25,21(17)35-20)9-10-26(18)4/h5-7,12-13,18,21,28,31H,8-11H2,1-4H3/t12-,13-,18+,21-,24?,25+/m0/s1 |
| InChIKey | VUZUUALLEKSJBC-OKJHCPSASA-N |
| XLogP | 1.10 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|