C23H28N2O7 — CID 122670338
(4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl) 2-(3-aminopropanoyloxy)propanoate (PubChem CID 122670338) has the molecular formula C23H28N2O7 and a molecular weight of 444.48 g/mol. Its IUPAC name is (4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl) 2-(3-aminopropanoyloxy)propanoate.
| Compound Name | (4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl) 2-(3-aminopropanoyloxy)propanoate |
|---|---|
| PubChem CID | 122670338 |
| Molecular Formula | C23H28N2O7 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | (4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl) 2-(3-aminopropanoyloxy)propanoate |
| SMILES | CC(OC(=O)CCN)C(=O)OC1=CCC2(O)C3Cc4ccc(O)c5c4C2(CCN3C)C1O5 |
| InChI | InChI=1S/C23H28N2O7/c1-12(30-17(27)6-9-24)21(28)31-15-5-7-23(29)16-11-13-3-4-14(26)19-18(13)22(23,20(15)32-19)8-10-25(16)2/h3-5,12,16,20,26,29H,6-11,24H2,1-2H3 |
| InChIKey | KLMIQGRBFKHLOG-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 131.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |