C25H31NO7 — CID 160749315
[(4R,4aS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] (2R,6R)-6-hydroxy-2-methyl-4-oxoheptanoate (PubChem CID 160749315) has the molecular formula C25H31NO7 and a molecular weight of 457.52 g/mol. Its IUPAC name is [(4R,4aS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] (2R,6R)-6-hydroxy-2-methyl-4-oxoheptanoate.
| Compound Name | [(4R,4aS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] (2R,6R)-6-hydroxy-2-methyl-4-oxoheptanoate |
|---|---|
| PubChem CID | 160749315 |
| Molecular Formula | C25H31NO7 |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | [(4R,4aS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] (2R,6R)-6-hydroxy-2-methyl-4-oxoheptanoate |
| SMILES | C[C@H](CC(=O)C[C@@H](C)O)C(=O)OC1=CC[C@@]2(O)[C@H]3Cc4ccc(O)c5c4C2(CCN3C)C1O5 |
| InChI | InChI=1S/C25H31NO7/c1-13(10-16(28)11-14(2)27)23(30)32-18-6-7-25(31)19-12-15-4-5-17(29)21-20(15)24(25,22(18)33-21)8-9-26(19)3/h4-6,13-14,19,22,27,29,31H,7-12H2,1-3H3/t13-,14-,19-,22?,24?,25-/m1/s1 |
| InChIKey | XRRCFPFNDHPFLD-LNGIAUJHSA-N |
| XLogP | 1.58 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |