C25H33NO4 — CID 69036845
(4R,7aR,12bR)-3-(cyclopropylmethyl)-9-methoxy-7a-methyl-4a-propoxy-1,2,4,5,6,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one (PubChem CID 69036845) has the molecular formula C25H33NO4 and a molecular weight of 411.54 g/mol. Its IUPAC name is (4R,7aR,12bR)-3-(cyclopropylmethyl)-9-methoxy-7a-methyl-4a-propoxy-1,2,4,5,6,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one.
| Compound Name | (4R,7aR,12bR)-3-(cyclopropylmethyl)-9-methoxy-7a-methyl-4a-propoxy-1,2,4,5,6,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
|---|---|
| PubChem CID | 69036845 |
| Molecular Formula | C25H33NO4 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | (4R,7aR,12bR)-3-(cyclopropylmethyl)-9-methoxy-7a-methyl-4a-propoxy-1,2,4,5,6,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
| SMILES | CCCOC12CCC(=O)[C@]3(C)Oc4c(OC)ccc5c4[C@]13CCN(CC1CC1)[C@@H]2C5 |
| InChI | InChI=1S/C25H33NO4/c1-4-13-29-25-10-9-20(27)23(2)24(25)11-12-26(15-16-5-6-16)19(25)14-17-7-8-18(28-3)22(30-23)21(17)24/h7-8,16,19H,4-6,9-15H2,1-3H3/t19-,23+,24+,25?/m1/s1 |
| InChIKey | WVEQMQRCSCRGHR-PCWCUDFHSA-N |
| XLogP | 3.65 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |