C28H33NO4 — CID 21456735
(1R,9S,10S)-17-(cyclopropylmethyl)-4-hydroxy-3-methoxy-10-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one (PubChem CID 21456735) has the molecular formula C28H33NO4 and a molecular weight of 447.58 g/mol. Its IUPAC name is (1R,9S,10S)-17-(cyclopropylmethyl)-4-hydroxy-3-methoxy-10-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one.
| Compound Name | (1R,9S,10S)-17-(cyclopropylmethyl)-4-hydroxy-3-methoxy-10-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one |
|---|---|
| PubChem CID | 21456735 |
| Molecular Formula | C28H33NO4 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | (1R,9S,10S)-17-(cyclopropylmethyl)-4-hydroxy-3-methoxy-10-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one |
| SMILES | COc1c(O)ccc2c1[C@]13CCN(CC4CC4)[C@@H](C2)[C@]1(OCc1ccccc1)CCC(=O)C3 |
| InChI | InChI=1S/C28H33NO4/c1-32-26-23(31)10-9-21-15-24-28(33-18-20-5-3-2-4-6-20)12-11-22(30)16-27(28,25(21)26)13-14-29(24)17-19-7-8-19/h2-6,9-10,19,24,31H,7-8,11-18H2,1H3/t24-,27+,28+/m0/s1 |
| InChIKey | PNPHHHZLKPSTTM-HNPKZYAISA-N |
| XLogP | 4.39 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |