C30H33NO4 — CID 10073499
(1R,10S)-3,4-dimethoxy-17-methyl-10-(naphthalen-2-ylmethoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one (PubChem CID 10073499) has the molecular formula C30H33NO4 and a molecular weight of 471.60 g/mol. Its IUPAC name is (1R,10S)-3,4-dimethoxy-17-methyl-10-(naphthalen-2-ylmethoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one.
| Compound Name | (1R,10S)-3,4-dimethoxy-17-methyl-10-(naphthalen-2-ylmethoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one |
|---|---|
| PubChem CID | 10073499 |
| Molecular Formula | C30H33NO4 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | (1R,10S)-3,4-dimethoxy-17-methyl-10-(naphthalen-2-ylmethoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one |
| SMILES | COc1ccc2c(c1OC)[C@]13CCN(C)C(C2)[C@]1(OCc1ccc2ccccc2c1)CCC(=O)C3 |
| InChI | InChI=1S/C30H33NO4/c1-31-15-14-29-18-24(32)12-13-30(29,35-19-20-8-9-21-6-4-5-7-22(21)16-20)26(31)17-23-10-11-25(33-2)28(34-3)27(23)29/h4-11,16,26H,12-15,17-19H2,1-3H3/t26?,29-,30-/m1/s1 |
| InChIKey | LJGNNTQVCORNBI-FHSDPKPXSA-N |
| XLogP | 5.06 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |