C29H37NO4 — CID 21456490
(1R,9S,10S)-3-butoxy-10-methoxy-17-methyl-4-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one (PubChem CID 21456490) has the molecular formula C29H37NO4 and a molecular weight of 463.62 g/mol. Its IUPAC name is (1R,9S,10S)-3-butoxy-10-methoxy-17-methyl-4-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one.
| Compound Name | (1R,9S,10S)-3-butoxy-10-methoxy-17-methyl-4-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one |
|---|---|
| PubChem CID | 21456490 |
| Molecular Formula | C29H37NO4 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | (1R,9S,10S)-3-butoxy-10-methoxy-17-methyl-4-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one |
| SMILES | CCCCOc1c(OCc2ccccc2)ccc2c1[C@]13CCN(C)[C@@H](C2)[C@]1(OC)CCC(=O)C3 |
| InChI | InChI=1S/C29H37NO4/c1-4-5-17-33-27-24(34-20-21-9-7-6-8-10-21)12-11-22-18-25-29(32-3)14-13-23(31)19-28(29,26(22)27)15-16-30(25)2/h6-12,25H,4-5,13-20H2,1-3H3/t25-,28+,29+/m0/s1 |
| InChIKey | WNVRBVSDSLJKCL-RFYMFKDESA-N |
| XLogP | 5.08 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|