C27H31NO5 — CID 129172721
(4'R,4'aS,7'aR)-4'a-methoxy-3'-methyl-9'-phenylmethoxyspiro[1,3-dioxolane-2,7'-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline] (PubChem CID 129172721) has the molecular formula C27H31NO5 and a molecular weight of 449.55 g/mol. Its IUPAC name is (4'R,4'aS,7'aR)-4'a-methoxy-3'-methyl-9'-phenylmethoxyspiro[1,3-dioxolane-2,7'-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline].
| Compound Name | (4'R,4'aS,7'aR)-4'a-methoxy-3'-methyl-9'-phenylmethoxyspiro[1,3-dioxolane-2,7'-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline] |
|---|---|
| PubChem CID | 129172721 |
| Molecular Formula | C27H31NO5 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | (4'R,4'aS,7'aR)-4'a-methoxy-3'-methyl-9'-phenylmethoxyspiro[1,3-dioxolane-2,7'-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline] |
| SMILES | CO[C@@]12CCC3(OCCO3)[C@@H]3Oc4c(OCc5ccccc5)ccc5c4C31CCN(C)[C@@H]2C5 |
| InChI | InChI=1S/C27H31NO5/c1-28-13-12-25-22-19-8-9-20(30-17-18-6-4-3-5-7-18)23(22)33-24(25)27(31-14-15-32-27)11-10-26(25,29-2)21(28)16-19/h3-9,21,24H,10-17H2,1-2H3/t21-,24-,25?,26-/m1/s1 |
| InChIKey | JWDNGHGDUCLBOA-VBZPYMABSA-N |
| XLogP | 3.45 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |