C36H37NO4 — CID 144582095
(1R,2S,6R,14R,15R,19R)-19-benzyl-5,19-dimethyl-11-phenylmethoxy-13,16,18-trioxa-5-azaheptacyclo[13.6.2.12,8.01,6.02,14.015,20.012,24]tetracosa-8(24),9,11,22-tetraene (PubChem CID 144582095) has the molecular formula C36H37NO4 and a molecular weight of 547.70 g/mol. Its IUPAC name is (1R,2S,6R,14R,15R,19R)-19-benzyl-5,19-dimethyl-11-phenylmethoxy-13,16,18-trioxa-5-azaheptacyclo[13.6.2.12,8.01,6.02,14.015,20.012,24]tetracosa-8(24),9,11,22-tetraene.
| Compound Name | (1R,2S,6R,14R,15R,19R)-19-benzyl-5,19-dimethyl-11-phenylmethoxy-13,16,18-trioxa-5-azaheptacyclo[13.6.2.12,8.01,6.02,14.015,20.012,24]tetracosa-8(24),9,11,22-tetraene |
|---|---|
| PubChem CID | 144582095 |
| Molecular Formula | C36H37NO4 |
| Molecular Weight | 547.70 g/mol |
| Exact Mass | 547.27 |
| IUPAC Name | (1R,2S,6R,14R,15R,19R)-19-benzyl-5,19-dimethyl-11-phenylmethoxy-13,16,18-trioxa-5-azaheptacyclo[13.6.2.12,8.01,6.02,14.015,20.012,24]tetracosa-8(24),9,11,22-tetraene |
| SMILES | CN1CC[C@]23c4c5ccc(OCc6ccccc6)c4O[C@H]2[C@@]24C=C[C@@]3(CC2[C@@](C)(Cc2ccccc2)OCO4)[C@H]1C5 |
| InChI | InChI=1S/C36H37NO4/c1-33(20-24-9-5-3-6-10-24)28-21-34-15-16-36(28,40-23-39-33)32-35(34)17-18-37(2)29(34)19-26-13-14-27(31(41-32)30(26)35)38-22-25-11-7-4-8-12-25/h3-16,28-29,32H,17-23H2,1-2H3/t28?,29-,32-,33-,34-,35+,36-/m1/s1 |
| InChIKey | ZCFYLJWIIQSFEP-LBOAJHMWSA-N |
| XLogP | 5.85 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.70 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|