C28H29NO4 — CID 138756679
[(1R,2S,6R,14R,16S)-11,15-dimethoxy-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraen-16-yl]-phenylmethanone (PubChem CID 138756679) has the molecular formula C28H29NO4 and a molecular weight of 443.54 g/mol. Its IUPAC name is [(1R,2S,6R,14R,16S)-11,15-dimethoxy-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraen-16-yl]-phenylmethanone.
| Compound Name | [(1R,2S,6R,14R,16S)-11,15-dimethoxy-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraen-16-yl]-phenylmethanone |
|---|---|
| PubChem CID | 138756679 |
| Molecular Formula | C28H29NO4 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | [(1R,2S,6R,14R,16S)-11,15-dimethoxy-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraen-16-yl]-phenylmethanone |
| SMILES | COc1ccc2c3c1O[C@H]1C4(OC)C=C[C@@]5(CC4C(=O)c4ccccc4)[C@@H](C2)N(C)CC[C@]315 |
| InChI | InChI=1S/C28H29NO4/c1-29-14-13-27-22-18-9-10-20(31-2)24(22)33-25(27)28(32-3)12-11-26(27,21(29)15-18)16-19(28)23(30)17-7-5-4-6-8-17/h4-12,19,21,25H,13-16H2,1-3H3/t19?,21-,25-,26-,27+,28?/m1/s1 |
| InChIKey | VPHUGMTYIBMWQC-JZAQZOFQSA-N |
| XLogP | 3.80 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|