C26H32N2O6 — CID 98105598
ethyl 2-[[(1S,2S,6R,14S,15R,16S)-11,15-dimethoxy-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraene-16-carbonyl]amino]acetate (PubChem CID 98105598) has the molecular formula C26H32N2O6 and a molecular weight of 468.55 g/mol. Its IUPAC name is ethyl 2-[[(1S,2S,6R,14S,15R,16S)-11,15-dimethoxy-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraene-16-carbonyl]amino]acetate.
| Compound Name | ethyl 2-[[(1S,2S,6R,14S,15R,16S)-11,15-dimethoxy-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraene-16-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 98105598 |
| Molecular Formula | C26H32N2O6 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | ethyl 2-[[(1S,2S,6R,14S,15R,16S)-11,15-dimethoxy-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraene-16-carbonyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)[C@H]1C[C@]23C=C[C@]1(OC)[C@H]1Oc4c(OC)ccc5c4[C@@]12CCN(C)[C@@H]3C5 |
| InChI | InChI=1S/C26H32N2O6/c1-5-33-19(29)14-27-22(30)16-13-24-8-9-26(16,32-4)23-25(24)10-11-28(2)18(24)12-15-6-7-17(31-3)21(34-23)20(15)25/h6-9,16,18,23H,5,10-14H2,1-4H3,(H,27,30)/t16-,18-,23+,24+,25+,26-/m1/s1 |
| InChIKey | BZFQPXQZBYDBBG-PAFDHOCESA-N |
| XLogP | 1.59 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|