C39H49N3O7 — CID 163058274
ethyl 2-[[2-[(11,15-dimethoxy-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraene-16-carbonyl)amino]-3-phenylpropanoyl]amino]-4-methylpentanoate (PubChem CID 163058274) has the molecular formula C39H49N3O7 and a molecular weight of 671.84 g/mol. Its IUPAC name is ethyl 2-[[2-[(11,15-dimethoxy-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraene-16-carbonyl)amino]-3-phenylpropanoyl]amino]-4-methylpentanoate.
| Compound Name | ethyl 2-[[2-[(11,15-dimethoxy-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraene-16-carbonyl)amino]-3-phenylpropanoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 163058274 |
| Molecular Formula | C39H49N3O7 |
| Molecular Weight | 671.84 g/mol |
| Exact Mass | 671.36 |
| IUPAC Name | ethyl 2-[[2-[(11,15-dimethoxy-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraene-16-carbonyl)amino]-3-phenylpropanoyl]amino]-4-methylpentanoate |
| SMILES | CCOC(=O)C(CC(C)C)NC(=O)C(Cc1ccccc1)NC(=O)C1CC23C=CC1(OC)C1Oc4c(OC)ccc5c4C12CCN(C)C3C5 |
| InChI | InChI=1S/C39H49N3O7/c1-7-48-35(45)28(19-23(2)3)41-34(44)27(20-24-11-9-8-10-12-24)40-33(43)26-22-37-15-16-39(26,47-6)36-38(37)17-18-42(4)30(37)21-25-13-14-29(46-5)32(49-36)31(25)38/h8-16,23,26-28,30,36H,7,17-22H2,1-6H3,(H,40,43)(H,41,44) |
| InChIKey | RQZDWSUDRWEDPG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.84 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|